Crosslinked Networks (examples/spes_network) ======================================================= This tutorial demonstrates how to model a crosslinked Solid Polymer Electrolyte (SPE) network. Unlike previous tutorials where chains were pre-built, here we simulate the **in-situ polymerization** process. The system consists of: * **Precursors**: Mono-functional acrylates (A-B) and Di-functional crosslinkers (A-C-A). * **Electrolyte**: Lithium salt (LiTFSI) and Succinonitrile (SN) solvent. * **Reaction**: Vinyl polymerization of the acrylate groups to form a 3D network. Key features: 1. **Reactive CG Simulation**: Using DoMD to define reaction templates that are executed dynamically during the CG simulation (via HOOMD-blue/PyGAMD). 2. **Regiospecific Control**: Defining strict SMARTS patterns to control reaction products (e.g., Head-to-Tail connectivity). 3. **Hybrid Force Field Strategy**: Applying different parameterization methods based on molecule size and type. .. note:: This tutorial assumes you have configured the environment and database as described in the :doc:`../index`. Step 1: Chemical Definitions & Reaction Rules --------------------------------------------- We define the components and the reaction rules. * **A**: Acrylic Acid group (C=C center). * **B**: Butanol tail. * **C**: PEG crosslinker chain. * **L/T**: Li+ and TFSI-. * **S**: Succinonitrile (Solvent). .. important:: **Regiospecificity: Bridging Isotropic Beads and Anisotropic Chemistry** In Coarse-Grained (CG) simulations, reactions (e.g., ``A + A -> A-A``) are typically triggered by spatial proximity, treating beads as isotropic spheres without inherent directionality. However, the resulting all-atom chemistry is strictly **regiospecific**. For vinyl polymerization, the connectivity direction determines the microstructure. While **Head-to-Tail (H-T)** is common, **Head-to-Head (H-H)** or **Tail-to-Tail (T-T)** linkages are chemically valid structures that may occur under specific synthetic conditions: * **Head-to-Tail (H-T)**: ``-CH2-CH(R)-CH2-CH(R)-`` * **Head-to-Head (H-H)**: ``-CH2-CH(R)-CH(R)-CH2-`` * **Tail-to-Tail (T-T)**: ``-CH(R)-CH2-CH2-CH(R)-`` **The "What You See Is What You Get" Principle:** ChemFAST does not enforce "standard" chemistry; it strictly executes the topology defined by your inputs. Therefore: 1. **Define SMARTS Precisely**: You must write the SMARTS pattern to explicitly define the atom mapping for the desired topology (H-T, H-H, or T-T). 2. **Match Reaction Recording**: Ensure that the reactant indices recorded by the CG engine (HOOMD-blue/PyGAMD) match the order of reactants in your SMARTS. * **Example (H-T)**: ``[C:1]=[C:2](R).[C:3]=[C:4](R) >> [C:1][C:2](R)[C:3][C:4](R)`` * *This SMARTS specifically instructs the software to connect the "Tail" ([C:2]) of the first monomer to the "Head" ([C:3]) of the second.* .. code-block:: python import sys from domd_tools import create_cg_system, build_aa_topology, assign_ff_parameters, get_gmx from misc.logger import logger logger.setLevel('INFO') # 1. Define Components smiA = 'C=CC(=O)O' # Acrylate monomer (reactive) smiB = 'OCCCC' # Butyl tail smiC = 'OCCOCCOCCOCCO' # PEG Crosslinker smiL = '[Li+]' # Lithium smiT = 'C(F)(F)(F)S(=O)(=O)[N-]S(=O)(=O)C(F)(F)(F)' # TFSI smiS = 'N#CCCC#N' # Succinonitrile # 2. Define Reaction Rules reaction_template = { # Vinyl Polymerization (Crosslinking Step) # Note: The SMARTS specifies the mapping of the C=C double bond opening 'A-A': { 'cg_reactant_list': [('A', 'A')], 'smarts': '[C:1]=[C:2]C(=O)O.[C:3]=CC(=O)O>>[C:1][C:2](C(=O)O)[C:3]=CC(=O)O', 'prod_idx': [0] }, # Pre-cursor formation (Acid + Alcohol -> Ester) # These might be pre-reacted or reacted in-situ depending on simulation stage 'A-B': { 'cg_reactant_list': [('A', 'B')], 'smarts': 'C(=O)[#8H1:1].[#6:2][#8H1:3]>>C(=O)[#8:3][#6:2].[#8:1]', 'prod_idx': [0] }, 'A-C': { 'cg_reactant_list': [('A', 'C')], 'smarts': 'C(=O)[#8H1:1].[#6:2][#8H1:3]>>C(=O)[#8:3][#6:2].[#8:1]', 'prod_idx': [0] }, # Dummy reaction for single ions/solvents to ensure they pass through 'S': { 'cg_reactant_list': [('L',), ('T',), ('S',)], 'smarts': '*>>*', 'prod_idx': [0], } } mols = { 'A': {'smiles': smiA, 'file': None}, 'B': {'smiles': smiB, 'file': None}, 'C': {'smiles': smiC, 'file': None}, 'L': {'smiles': smiL, 'file': None}, 'T': {'smiles': smiT, 'file': None}, 'S': {'smiles': smiS, 'file': None}, } Step 2: Generate Initial CG System ------------------------------------- We initialize the system with **precursors** rather than a fully formed network. The network will be formed during the CG simulation step. * **Meta 1**: A-B (Butyl Acrylate monomer). * **Meta 2**: A-C-A (PEG Diacrylate crosslinker). * **Meta 3/4/5**: Solvents and Ions. .. code-block:: python # System Composition n_ba = 30000 # Number of Butyl Acrylate precursors n_pegda = int(n_ba * 0.01) # 1% Crosslinker n_sn = int(n_ba * 12/7) # Solvent n_L = int(2 * n_ba/7) # LiTFSI # Define Precursor Topologies meta1 = { 'type': ['A','B'], 'bond': '0-1', 'N': n_ba, 'is_rigid': False, 'is_angle': True } meta2 = { 'type': ['A','C','A'], 'bond': '0-1,1-2', 'N': n_pegda, 'is_rigid': False, 'is_angle': True } meta3 = { 'type': ['S'], 'N': n_sn, 'is_rigid': False, 'is_angle': True } meta4 = { 'type': ['L'], 'N': n_L , 'is_rigid': False, 'is_angle': True } meta5 = { 'type': ['T'], 'N': n_L , 'is_rigid': False, 'is_angle': True } # Corrected type to 'T' metas = [meta1, meta2, meta3, meta4, meta5] # Generate Initial "Soup" create_cg_system(mols, reaction_template, metas) **Outputs:** * ``out_chemfast_cg.xml``: Contains the unconnected precursors mixed with solvents/ions. Step 3: Reactive CG Simulation (Polymerization) ----------------------------------------------- This is the most critical step. You must run a simulation that supports topology changes (bond formation). **External Protocol (HOOMD-blue / PyGAMD):** 1. Load ``out_chemfast_cg.xml``. 2. **Define Reaction Criteria**: Set the reaction radius and probability for the ``A-A`` reaction defined in Step 1. 3. **Run Dynamics**: As beads diffuse and collide, 'A' beads will bond to form the polyacrylate backbone, crosslinked by 'C' chains. 4. **Equilibrate**: After the reaction reaches the desired conversion (e.g., 90%), continue relaxing the network. 5. Save the final crosslinked network as ``CG_pre_eq/final.xml``. .. image:: ../_static/network_polymerization.png :align: center :alt: Polymerization at CG scale to generate network topology :width: 600px Step 4: All-Atom Topology Building ------------------------------- DoMD reconstructs the complex, irregular network topology from the reacted CG snapshot. .. code-block:: python # Path to the reacted, crosslinked network snapshot xmlfile = 'CG_pre_eq/final.xml' # Reconstruct AA Topology # chunks_per_d=5 is highly recommended for infinite networks to save memory confs, mol_graphs, box = build_aa_topology( mols, reaction_template, xmlfile, chunks_per_d=5 ) Step 5: Force Field Assignment ----------------------------------- A crosslinked network is essentially one giant molecule (Infinite Cluster). Standard template matching can fail on such irregular structures. We use a **Size-Dependent Hybrid Strategy**: * **Giant Molecules (>20 atoms)**: The Polymer Network. Use **ML** (GATs) for robust parameterization of the irregular backbone. * **Single Ions (1 atom)**: Li+. Use **TPL** (Templates) for standard OPLS parameters. * **Small Molecules**: TFSI / Solvent. Use **Hybrid** (DB + ML fallback). .. code-block:: python strategies = [] for mol in mol_graphs: if mol.number_of_nodes() > 20: strategies.append('ml') # Network / Oligomers elif mol.number_of_nodes() == 1: strategies.append('tpl') # Li+ ions else: strategies.append('hybrid') # TFSI, Succinonitrile # Assign Parameters ffs = assign_ff_parameters(mol_graphs, strategies=strategies) # Export get_gmx(mol_graphs, confs, ffs, box) **Final Outputs:** The generated ``chemfast.gro`` and ``chemfast.top`` represent a chemically specific, crosslinked polymer electrolyte network swollen with solvent and ions, ready for conductivity simulations.