Brush Polymer (examples/spes_brush)
This tutorial demonstrates how to model complex Solid Polymer Electrolytes (SPEs) using DoMD. We will construct a polymer brush system consisting of a fluorinated backbone with PEO side chains and Lithium ions.
This case study highlights advanced features of DoMD:
Programmatic Topology: Using Python loops to define complex brush/comb architectures.
Specific FF Strategies: Applying different parameterization strategies (ML vs. Template) for polymers and ions.
Large Molecule Backmapping: Handling spatial decomposition for efficient embedding.
Note
This tutorial assumes you have configured the environment and database as described in the DoMD (ChemFAST) Documentation.
Step 1: Chemical Definitions
We define a system with four components:
F: A fluorinated monomer (acting as part of the backbone/linker).
P: A connector unit (backbone).
O: PEO repeating units (side chains).
L: Lithium ions.
The reaction template defines the connectivity rules for these diverse components.
import sys
from domd_tools import create_cg_system, build_aa_topology, assign_ff_parameters, get_gmx
from misc.logger import logger
logger.setLevel('INFO')
# 1. Define Components
smiF = 'CC(C(F)(F)(F))C(=O)[N-]S(=O)(=O)C(F)(F)(F)' # TFSI-like / Fluorinated unit
smiP = 'CCO' # Backbone connector
smiO = 'CCO' # PEO unit
smiL = '[Li+]' # Lithium Ion
# 2. Define Reaction Rules
reaction_template = {
'F-P': {
'cg_reactant_list': [('P', 'F')],
'smarts': '[CH3,CH2:1].[CH1,CH3:2]>>[C:1][C:2]',
'prod_idx': [0]
},
'O-P': {
'cg_reactant_list': [('P', 'O')],
'smarts': '[OH1:1].[CH3:2][CH2:3]>>[O:1][C:2][C:3]',
'prod_idx': [0]
},
'O-O': {
'cg_reactant_list': [('O', 'O')],
'smarts': '[CH3:1].[O:2]>>[C:1][O:2]',
'prod_idx': [0]
},
'S': {
'cg_reactant_list': [('L',)],
'smarts': '*>>*',
'prod_idx': [0],
}
}
mols = {
'F': {'smiles': smiF, 'file': None},
'P': {'smiles': smiP, 'file': None},
'O': {'smiles': smiO, 'file': None},
'L': {'smiles': smiL, 'file': None},
}
Step 2: Generate Initial CG System (Brush)
Unlike simple linear chains, a polymer brush has a comb-like structure. DoMD allows you to define arbitrary connectivity using Python logic.
Target Structure: The code below constructs a backbone of alternating P and F units, where each P unit holds a PEO side chain (O-O-O…).
|
P-O-O-O-O-O-O-O... (Side Chain)
|
F
|
P-O-O-O-O-O-O-O...
|
# System Parameters
n_chain = 500 # Number of polymer chains
cl = 20 # Chain length (number of repeating blocks)
n_L = 10000 # Number of Lithium ions
# Programmatic Topology Generation
bonds = []
# Loop over chain length to define connectivity
for ic in range(cl):
# 1. Connect Backbone P (0) to first Side Chain O (1)
bonds.append(f'{ic*15+0}-{ic*15+1}')
# 2. Build Side Chain (O-O bonds)
for i in range(1, 13):
bonds.append(f'{ic*15+i}-{ic*15+i+1}')
# 3. Connect Backbone P (0) to Backbone F (14)
bonds.append(f'{ic*15+0}-{ic*15+14}')
# 4. Connect Backbone F (14) of current block to P (0) of next block
for ic in range(cl-1):
bonds.append(f'{ic*15+14}-{ic*15+15}')
# Create the bond string
top_str = ','.join(bonds)
# Define Metadata
# Sequence: P, 13*O, F (Total 15 beads per block)
meta1 = {
'type': ['P','O','O','O','O','O','O','O','O','O','O','O','O','O','F'] * cl,
'bond': top_str,
'N': n_chain,
'is_rigid': False,
'is_angle': True
}
# Define Ions (Free particles)
meta2 = {
'type': ['L'],
'N': n_L,
'is_rigid': False,
'is_angle': True
}
# Generate CG System
create_cg_system(mols, reaction_template, [meta1, meta2], rho=0.3)
Outputs from Step 2:
out_chemfast_cg.xml: Initial CG configuration including the complex brush topology.cg_params.txt: Derived force field parameters.
Step 3: CG Pre-equilibration (Simulation)
Run the coarse-grained simulation to relax this dense brush system.
Important
External Simulation Step:
Take the
out_chemfast_cg.xmlgenerated in Step 2.Run a molecular dynamics simulation (HOOMD-blue/GALAMOST).
Ensure the ions diffuse and the brushes relax from their initial generation state.
Save the final frame as
CG_pre_eq/final.xml.
Step 4: All-Atom Topology Building
We reconstruct the all-atom coordinates. Note the use of chunks_per_d=5.
Tip
Handling Large Molecules:
For high molecular weight polymers (like these brushes), standard embedding can be slow. Setting chunks_per_d=5 splits the molecule into spatial chunks for efficient parallel reconstruction.
xmlfile = 'CG_pre_eq/final.xml'
# Backmapping with spatial decomposition
confs, mol_graphs, box = build_aa_topology(
mols,
reaction_template,
xmlfile,
chunks_per_d=5
)
Step 5: Force Field Assignment
For this system, we use a mixed parameterization strategy to optimize accuracy and speed:
Polymer Brushes (>20 atoms): Use ML (Machine Learning) for accurate charge and parameter prediction of the complex polymeric structure.
Lithium Ions (1 atom): Use TPL (Template) rules to strictly follow standard library parameters (e.g., OPLS-AA ion parameters).
strategies = []
# Iterate through all molecules to assign strategies
for mol in mol_graphs:
if mol.number_of_nodes() > 20:
strategies.append('ml') # Use Graph Attention Network for brushes
elif mol.number_of_nodes() == 1:
strategies.append('tpl') # Use standard library rules for ions
# Assign parameters
ffs = assign_ff_parameters(mol_graphs, strategies=strategies)
# Export to GROMACS
get_gmx(mol_graphs, confs, ffs, box)
Final Outputs:
* spes_brush_final.gro
* spes_brush_final.top
The system is now ready for ion transport simulations in GROMACS.